C17H12ClF2N — CID 82772989
(4-chloro-2,5-difluorophenyl)-naphthalen-1-ylmethanamine (PubChem CID 82772989) has the molecular formula C17H12ClF2N and a molecular weight of 303.74 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-naphthalen-1-ylmethanamine.
| Compound Name | (4-chloro-2,5-difluorophenyl)-naphthalen-1-ylmethanamine |
|---|---|
| PubChem CID | 82772989 |
| Molecular Formula | C17H12ClF2N |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-naphthalen-1-ylmethanamine |
| SMILES | NC(c1cc(F)c(Cl)cc1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H12ClF2N/c18-14-9-15(19)13(8-16(14)20)17(21)12-7-3-5-10-4-1-2-6-11(10)12/h1-9,17H,21H2 |
| InChIKey | WGXXZTCQFLLKHT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|