C17H18ClF2N — CID 105050632
(4-chloro-2,5-difluorophenyl)-[3-(2-methylpropyl)phenyl]methanamine (PubChem CID 105050632) has the molecular formula C17H18ClF2N and a molecular weight of 309.79 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-[3-(2-methylpropyl)phenyl]methanamine.
| Compound Name | (4-chloro-2,5-difluorophenyl)-[3-(2-methylpropyl)phenyl]methanamine |
|---|---|
| PubChem CID | 105050632 |
| Molecular Formula | C17H18ClF2N |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-[3-(2-methylpropyl)phenyl]methanamine |
| SMILES | CC(C)Cc1cccc(C(N)c2cc(F)c(Cl)cc2F)c1 |
| InChI | InChI=1S/C17H18ClF2N/c1-10(2)6-11-4-3-5-12(7-11)17(21)13-8-16(20)14(18)9-15(13)19/h3-5,7-10,17H,6,21H2,1-2H3 |
| InChIKey | UCAXXVYJALKAJH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|