C16H18Cl2N2 — CID 116544792
(3,5-dichloro-2-pyridinyl)-[3-(2-methylpropyl)phenyl]methanamine (PubChem CID 116544792) has the molecular formula C16H18Cl2N2 and a molecular weight of 309.24 g/mol. Its IUPAC name is (3,5-dichloro-2-pyridinyl)-[3-(2-methylpropyl)phenyl]methanamine.
| Compound Name | (3,5-dichloro-2-pyridinyl)-[3-(2-methylpropyl)phenyl]methanamine |
|---|---|
| PubChem CID | 116544792 |
| Molecular Formula | C16H18Cl2N2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (3,5-dichloro-2-pyridinyl)-[3-(2-methylpropyl)phenyl]methanamine |
| SMILES | CC(C)Cc1cccc(C(N)c2ncc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H18Cl2N2/c1-10(2)6-11-4-3-5-12(7-11)15(19)16-14(18)8-13(17)9-20-16/h3-5,7-10,15H,6,19H2,1-2H3 |
| InChIKey | CEIAYBPKSOPJEJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |