C17H17ClF2O — CID 115838226
(4-chloro-2,5-difluorophenyl)-[3-(2-methylpropyl)phenyl]methanol (PubChem CID 115838226) has the molecular formula C17H17ClF2O and a molecular weight of 310.77 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-[3-(2-methylpropyl)phenyl]methanol.
| Compound Name | (4-chloro-2,5-difluorophenyl)-[3-(2-methylpropyl)phenyl]methanol |
|---|---|
| PubChem CID | 115838226 |
| Molecular Formula | C17H17ClF2O |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-[3-(2-methylpropyl)phenyl]methanol |
| SMILES | CC(C)Cc1cccc(C(O)c2cc(F)c(Cl)cc2F)c1 |
| InChI | InChI=1S/C17H17ClF2O/c1-10(2)6-11-4-3-5-12(7-11)17(21)13-8-16(20)14(18)9-15(13)19/h3-5,7-10,17,21H,6H2,1-2H3 |
| InChIKey | BTQBZHRWYKTDDF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|