C15H9BrClF2NS — CID 82773003
(7-bromo-1-benzothiophen-3-yl)-(4-chloro-2,5-difluorophenyl)methanamine (PubChem CID 82773003) has the molecular formula C15H9BrClF2NS and a molecular weight of 388.66 g/mol. Its IUPAC name is (7-bromo-1-benzothiophen-3-yl)-(4-chloro-2,5-difluorophenyl)methanamine.
| Compound Name | (7-bromo-1-benzothiophen-3-yl)-(4-chloro-2,5-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 82773003 |
| Molecular Formula | C15H9BrClF2NS |
| Molecular Weight | 388.66 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | (7-bromo-1-benzothiophen-3-yl)-(4-chloro-2,5-difluorophenyl)methanamine |
| SMILES | NC(c1cc(F)c(Cl)cc1F)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C15H9BrClF2NS/c16-10-3-1-2-7-9(6-21-15(7)10)14(20)8-4-13(19)11(17)5-12(8)18/h1-6,14H,20H2 |
| InChIKey | FDUMBGRGBHBWPH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|