C15H8Br2Cl2S — CID 81147356
7-bromo-3-[bromo-(2,4-dichlorophenyl)methyl]-1-benzothiophene (PubChem CID 81147356) has the molecular formula C15H8Br2Cl2S and a molecular weight of 451.01 g/mol. Its IUPAC name is 7-bromo-3-[bromo-(2,4-dichlorophenyl)methyl]-1-benzothiophene.
| Compound Name | 7-bromo-3-[bromo-(2,4-dichlorophenyl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 81147356 |
| Molecular Formula | C15H8Br2Cl2S |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 447.81 |
| IUPAC Name | 7-bromo-3-[bromo-(2,4-dichlorophenyl)methyl]-1-benzothiophene |
| SMILES | Clc1ccc(C(Br)c2csc3c(Br)cccc23)c(Cl)c1 |
| InChI | InChI=1S/C15H8Br2Cl2S/c16-12-3-1-2-9-11(7-20-15(9)12)14(17)10-5-4-8(18)6-13(10)19/h1-7,14H |
| InChIKey | VTSAGQLQYRVBEP-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|