C16H12BrClFNS — CID 81131706
1-(7-bromo-1-benzothiophen-3-yl)-1-(4-chloro-2-fluorophenyl)-N-methylmethanamine (PubChem CID 81131706) has the molecular formula C16H12BrClFNS and a molecular weight of 384.70 g/mol. Its IUPAC name is 1-(7-bromo-1-benzothiophen-3-yl)-1-(4-chloro-2-fluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(7-bromo-1-benzothiophen-3-yl)-1-(4-chloro-2-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 81131706 |
| Molecular Formula | C16H12BrClFNS |
| Molecular Weight | 384.70 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | 1-(7-bromo-1-benzothiophen-3-yl)-1-(4-chloro-2-fluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Cl)cc1F)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C16H12BrClFNS/c1-20-15(11-6-5-9(18)7-14(11)19)12-8-21-16-10(12)3-2-4-13(16)17/h2-8,15,20H,1H3 |
| InChIKey | HZCJDHWNFYWODZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |