C14H11BrClNOS — CID 106684548
1-(7-bromo-1-benzothiophen-3-yl)-1-(5-chlorofuran-2-yl)-N-methylmethanamine (PubChem CID 106684548) has the molecular formula C14H11BrClNOS and a molecular weight of 356.67 g/mol. Its IUPAC name is 1-(7-bromo-1-benzothiophen-3-yl)-1-(5-chlorofuran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(7-bromo-1-benzothiophen-3-yl)-1-(5-chlorofuran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106684548 |
| Molecular Formula | C14H11BrClNOS |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 1-(7-bromo-1-benzothiophen-3-yl)-1-(5-chlorofuran-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Cl)o1)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C14H11BrClNOS/c1-17-13(11-5-6-12(16)18-11)9-7-19-14-8(9)3-2-4-10(14)15/h2-7,13,17H,1H3 |
| InChIKey | JOCNTKRJJLYAEP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |