C17H15BrFNS — CID 81480330
1-(7-bromo-1-benzothiophen-3-yl)-1-(2-fluoro-3-methylphenyl)-N-methylmethanamine (PubChem CID 81480330) has the molecular formula C17H15BrFNS and a molecular weight of 364.28 g/mol. Its IUPAC name is 1-(7-bromo-1-benzothiophen-3-yl)-1-(2-fluoro-3-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(7-bromo-1-benzothiophen-3-yl)-1-(2-fluoro-3-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 81480330 |
| Molecular Formula | C17H15BrFNS |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 1-(7-bromo-1-benzothiophen-3-yl)-1-(2-fluoro-3-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc(C)c1F)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C17H15BrFNS/c1-10-5-3-7-12(15(10)19)16(20-2)13-9-21-17-11(13)6-4-8-14(17)18/h3-9,16,20H,1-2H3 |
| InChIKey | GGTSKCNGMAIKNB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |