C15H13ClF3NO — CID 82772706
3-amino-1-(4-chloro-2,5-difluorophenyl)-2-(2-fluorophenyl)propan-1-ol (PubChem CID 82772706) has the molecular formula C15H13ClF3NO and a molecular weight of 315.72 g/mol. Its IUPAC name is 3-amino-1-(4-chloro-2,5-difluorophenyl)-2-(2-fluorophenyl)propan-1-ol.
| Compound Name | 3-amino-1-(4-chloro-2,5-difluorophenyl)-2-(2-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 82772706 |
| Molecular Formula | C15H13ClF3NO |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 3-amino-1-(4-chloro-2,5-difluorophenyl)-2-(2-fluorophenyl)propan-1-ol |
| SMILES | NCC(c1ccccc1F)C(O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C15H13ClF3NO/c16-11-6-13(18)9(5-14(11)19)15(21)10(7-20)8-3-1-2-4-12(8)17/h1-6,10,15,21H,7,20H2 |
| InChIKey | ZAVQCZOMDAKQCA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|