C17H20FNO — CID 65185462
3-amino-1-(2,4-dimethylphenyl)-2-(2-fluorophenyl)propan-1-ol (PubChem CID 65185462) has the molecular formula C17H20FNO and a molecular weight of 273.35 g/mol. Its IUPAC name is 3-amino-1-(2,4-dimethylphenyl)-2-(2-fluorophenyl)propan-1-ol.
| Compound Name | 3-amino-1-(2,4-dimethylphenyl)-2-(2-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 65185462 |
| Molecular Formula | C17H20FNO |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-amino-1-(2,4-dimethylphenyl)-2-(2-fluorophenyl)propan-1-ol |
| SMILES | Cc1ccc(C(O)C(CN)c2ccccc2F)c(C)c1 |
| InChI | InChI=1S/C17H20FNO/c1-11-7-8-13(12(2)9-11)17(20)15(10-19)14-5-3-4-6-16(14)18/h3-9,15,17,20H,10,19H2,1-2H3 |
| InChIKey | PYUGFEORNKLUIJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |