C15H9Br3S — CID 63443034
2,5-dibromo-3-[bromo(naphthalen-1-yl)methyl]thiophene (PubChem CID 63443034) has the molecular formula C15H9Br3S and a molecular weight of 461.02 g/mol. Its IUPAC name is 2,5-dibromo-3-[bromo(naphthalen-1-yl)methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[bromo(naphthalen-1-yl)methyl]thiophene |
|---|---|
| PubChem CID | 63443034 |
| Molecular Formula | C15H9Br3S |
| Molecular Weight | 461.02 g/mol |
| Exact Mass | 457.80 |
| IUPAC Name | 2,5-dibromo-3-[bromo(naphthalen-1-yl)methyl]thiophene |
| SMILES | Brc1cc(C(Br)c2cccc3ccccc23)c(Br)s1 |
| InChI | InChI=1S/C15H9Br3S/c16-13-8-12(15(18)19-13)14(17)11-7-3-5-9-4-1-2-6-10(9)11/h1-8,14H |
| InChIKey | HWKNBSSYDWRTPA-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.02 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|