C14H9Br2NOS — CID 107969656
(2,5-dibromothiophen-3-yl)-isoquinolin-4-ylmethanol (PubChem CID 107969656) has the molecular formula C14H9Br2NOS and a molecular weight of 399.11 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-isoquinolin-4-ylmethanol.
| Compound Name | (2,5-dibromothiophen-3-yl)-isoquinolin-4-ylmethanol |
|---|---|
| PubChem CID | 107969656 |
| Molecular Formula | C14H9Br2NOS |
| Molecular Weight | 399.11 g/mol |
| Exact Mass | 396.88 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-isoquinolin-4-ylmethanol |
| SMILES | OC(c1cc(Br)sc1Br)c1cncc2ccccc12 |
| InChI | InChI=1S/C14H9Br2NOS/c15-12-5-10(14(16)19-12)13(18)11-7-17-6-8-3-1-2-4-9(8)11/h1-7,13,18H |
| InChIKey | HHVOEEPVPQBPHQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.11 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |