C19H19N — CID 43149180
(3,4-dimethylphenyl)-naphthalen-1-ylmethanamine (PubChem CID 43149180) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-naphthalen-1-ylmethanamine.
| Compound Name | (3,4-dimethylphenyl)-naphthalen-1-ylmethanamine |
|---|---|
| PubChem CID | 43149180 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (3,4-dimethylphenyl)-naphthalen-1-ylmethanamine |
| SMILES | Cc1ccc(C(N)c2cccc3ccccc23)cc1C |
| InChI | InChI=1S/C19H19N/c1-13-10-11-16(12-14(13)2)19(20)18-9-5-7-15-6-3-4-8-17(15)18/h3-12,19H,20H2,1-2H3 |
| InChIKey | VBTLIIDVNNWYLF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |