C19H17NO — CID 63019163
1,3-dihydro-2-benzofuran-5-yl(naphthalen-1-yl)methanamine (PubChem CID 63019163) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran-5-yl(naphthalen-1-yl)methanamine.
| Compound Name | 1,3-dihydro-2-benzofuran-5-yl(naphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 63019163 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1,3-dihydro-2-benzofuran-5-yl(naphthalen-1-yl)methanamine |
| SMILES | NC(c1ccc2c(c1)COC2)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H17NO/c20-19(14-8-9-15-11-21-12-16(15)10-14)18-7-3-5-13-4-1-2-6-17(13)18/h1-10,19H,11-12,20H2 |
| InChIKey | YEGSXUKNDGOACN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |