C18H21NO2 — CID 105035897
1,3-dihydro-2-benzofuran-5-yl-(2-propoxyphenyl)methanamine (PubChem CID 105035897) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran-5-yl-(2-propoxyphenyl)methanamine.
| Compound Name | 1,3-dihydro-2-benzofuran-5-yl-(2-propoxyphenyl)methanamine |
|---|---|
| PubChem CID | 105035897 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1,3-dihydro-2-benzofuran-5-yl-(2-propoxyphenyl)methanamine |
| SMILES | CCCOc1ccccc1C(N)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C18H21NO2/c1-2-9-21-17-6-4-3-5-16(17)18(19)13-7-8-14-11-20-12-15(14)10-13/h3-8,10,18H,2,9,11-12,19H2,1H3 |
| InChIKey | UREGJEVNDMERJN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |