C10H13NO2 — CID 82600093
2-amino-2-(1,3-dihydro-2-benzofuran-5-yl)ethanol (PubChem CID 82600093) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-amino-2-(1,3-dihydro-2-benzofuran-5-yl)ethanol.
| Compound Name | 2-amino-2-(1,3-dihydro-2-benzofuran-5-yl)ethanol |
|---|---|
| PubChem CID | 82600093 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-amino-2-(1,3-dihydro-2-benzofuran-5-yl)ethanol |
| SMILES | NC(CO)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C10H13NO2/c11-10(4-12)7-1-2-8-5-13-6-9(8)3-7/h1-3,10,12H,4-6,11H2 |
| InChIKey | VVFDUTPMGYOIEP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |