C16H25NO — CID 63020921
1-(1,3-dihydro-2-benzofuran-5-yl)octan-1-amine (PubChem CID 63020921) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)octan-1-amine.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)octan-1-amine |
|---|---|
| PubChem CID | 63020921 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)octan-1-amine |
| SMILES | CCCCCCCC(N)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C16H25NO/c1-2-3-4-5-6-7-16(17)13-8-9-14-11-18-12-15(14)10-13/h8-10,16H,2-7,11-12,17H2,1H3 |
| InChIKey | OSSGISVEXJRKAH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|