C18H21Br — CID 55197972
2-[bromo-(3,4-dimethylphenyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 55197972) has the molecular formula C18H21Br and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-[bromo-(3,4-dimethylphenyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[bromo-(3,4-dimethylphenyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 55197972 |
| Molecular Formula | C18H21Br |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-[bromo-(3,4-dimethylphenyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(Br)c2ccc(C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C18H21Br/c1-11-8-14(4)17(15(5)9-11)18(19)16-7-6-12(2)13(3)10-16/h6-10,18H,1-5H3 |
| InChIKey | USQBCWOLWFBABT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|