C17H19Cl — CID 63430827
1-[chloro-(3,4-dimethylphenyl)methyl]-3,5-dimethylbenzene (PubChem CID 63430827) has the molecular formula C17H19Cl and a molecular weight of 258.79 g/mol. Its IUPAC name is 1-[chloro-(3,4-dimethylphenyl)methyl]-3,5-dimethylbenzene.
| Compound Name | 1-[chloro-(3,4-dimethylphenyl)methyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 63430827 |
| Molecular Formula | C17H19Cl |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[chloro-(3,4-dimethylphenyl)methyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(C(Cl)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C17H19Cl/c1-11-7-12(2)9-16(8-11)17(18)15-6-5-13(3)14(4)10-15/h5-10,17H,1-4H3 |
| InChIKey | GYUKVMXWKCBTRU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|