C16H17ClO — CID 63427206
4-[chloro-(4-methoxyphenyl)methyl]-1,2-dimethylbenzene (PubChem CID 63427206) has the molecular formula C16H17ClO and a molecular weight of 260.76 g/mol. Its IUPAC name is 4-[chloro-(4-methoxyphenyl)methyl]-1,2-dimethylbenzene.
| Compound Name | 4-[chloro-(4-methoxyphenyl)methyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 63427206 |
| Molecular Formula | C16H17ClO |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-[chloro-(4-methoxyphenyl)methyl]-1,2-dimethylbenzene |
| SMILES | COc1ccc(C(Cl)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C16H17ClO/c1-11-4-5-14(10-12(11)2)16(17)13-6-8-15(18-3)9-7-13/h4-10,16H,1-3H3 |
| InChIKey | XRGXJVZVHRLIEB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|