C16H16BrClO — CID 115369785
4-bromo-1-[chloro-(3,4-dimethylphenyl)methyl]-2-methoxybenzene (PubChem CID 115369785) has the molecular formula C16H16BrClO and a molecular weight of 339.66 g/mol. Its IUPAC name is 4-bromo-1-[chloro-(3,4-dimethylphenyl)methyl]-2-methoxybenzene.
| Compound Name | 4-bromo-1-[chloro-(3,4-dimethylphenyl)methyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 115369785 |
| Molecular Formula | C16H16BrClO |
| Molecular Weight | 339.66 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 4-bromo-1-[chloro-(3,4-dimethylphenyl)methyl]-2-methoxybenzene |
| SMILES | COc1cc(Br)ccc1C(Cl)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H16BrClO/c1-10-4-5-12(8-11(10)2)16(18)14-7-6-13(17)9-15(14)19-3/h4-9,16H,1-3H3 |
| InChIKey | FRMCJXUOTVDNKT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|