C16H16Cl2 — CID 106862844
2-chloro-1-[chloro-(3,4-dimethylphenyl)methyl]-4-methylbenzene (PubChem CID 106862844) has the molecular formula C16H16Cl2 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2-chloro-1-[chloro-(3,4-dimethylphenyl)methyl]-4-methylbenzene.
| Compound Name | 2-chloro-1-[chloro-(3,4-dimethylphenyl)methyl]-4-methylbenzene |
|---|---|
| PubChem CID | 106862844 |
| Molecular Formula | C16H16Cl2 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-chloro-1-[chloro-(3,4-dimethylphenyl)methyl]-4-methylbenzene |
| SMILES | Cc1ccc(C(Cl)c2ccc(C)c(C)c2)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2/c1-10-4-7-14(15(17)8-10)16(18)13-6-5-11(2)12(3)9-13/h4-9,16H,1-3H3 |
| InChIKey | VACRKWRXPGBEAD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|