C17H18Br2 — CID 113396942
2-[bromo-(4-bromo-3-methylphenyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 113396942) has the molecular formula C17H18Br2 and a molecular weight of 382.14 g/mol. Its IUPAC name is 2-[bromo-(4-bromo-3-methylphenyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[bromo-(4-bromo-3-methylphenyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 113396942 |
| Molecular Formula | C17H18Br2 |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 2-[bromo-(4-bromo-3-methylphenyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(Br)c2ccc(Br)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C17H18Br2/c1-10-7-12(3)16(13(4)8-10)17(19)14-5-6-15(18)11(2)9-14/h5-9,17H,1-4H3 |
| InChIKey | WGTLUSVKLNIJFG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|