C11H15Br2N — CID 90679723
2-bromo-2-(4-bromo-3-methylphenyl)-N,N-dimethylethanamine (PubChem CID 90679723) has the molecular formula C11H15Br2N and a molecular weight of 321.06 g/mol. Its IUPAC name is 2-bromo-2-(4-bromo-3-methylphenyl)-N,N-dimethylethanamine.
| Compound Name | 2-bromo-2-(4-bromo-3-methylphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 90679723 |
| Molecular Formula | C11H15Br2N |
| Molecular Weight | 321.06 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 2-bromo-2-(4-bromo-3-methylphenyl)-N,N-dimethylethanamine |
| SMILES | Cc1cc(C(Br)CN(C)C)ccc1Br |
| InChI | InChI=1S/C11H15Br2N/c1-8-6-9(4-5-10(8)12)11(13)7-14(2)3/h4-6,11H,7H2,1-3H3 |
| InChIKey | ZXOVCLDFTITNGK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.06 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|