C14H14Br2S — CID 63796148
3-bromo-2-[bromo-(2,4,6-trimethylphenyl)methyl]thiophene (PubChem CID 63796148) has the molecular formula C14H14Br2S and a molecular weight of 374.14 g/mol. Its IUPAC name is 3-bromo-2-[bromo-(2,4,6-trimethylphenyl)methyl]thiophene.
| Compound Name | 3-bromo-2-[bromo-(2,4,6-trimethylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 63796148 |
| Molecular Formula | C14H14Br2S |
| Molecular Weight | 374.14 g/mol |
| Exact Mass | 371.92 |
| IUPAC Name | 3-bromo-2-[bromo-(2,4,6-trimethylphenyl)methyl]thiophene |
| SMILES | Cc1cc(C)c(C(Br)c2sccc2Br)c(C)c1 |
| InChI | InChI=1S/C14H14Br2S/c1-8-6-9(2)12(10(3)7-8)13(16)14-11(15)4-5-17-14/h4-7,13H,1-3H3 |
| InChIKey | QMCFSPGSJSNJLW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.14 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|