C13H12Br2O2S — CID 80536988
3-bromo-2-[bromo-(3,5-dimethoxyphenyl)methyl]thiophene (PubChem CID 80536988) has the molecular formula C13H12Br2O2S and a molecular weight of 392.11 g/mol. Its IUPAC name is 3-bromo-2-[bromo-(3,5-dimethoxyphenyl)methyl]thiophene.
| Compound Name | 3-bromo-2-[bromo-(3,5-dimethoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 80536988 |
| Molecular Formula | C13H12Br2O2S |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 389.89 |
| IUPAC Name | 3-bromo-2-[bromo-(3,5-dimethoxyphenyl)methyl]thiophene |
| SMILES | COc1cc(OC)cc(C(Br)c2sccc2Br)c1 |
| InChI | InChI=1S/C13H12Br2O2S/c1-16-9-5-8(6-10(7-9)17-2)12(15)13-11(14)3-4-18-13/h3-7,12H,1-2H3 |
| InChIKey | NOUHTWCBFICCHH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|