C13H14BrNO2S — CID 55240103
(3-bromothiophen-2-yl)-(2,4-dimethoxyphenyl)methanamine (PubChem CID 55240103) has the molecular formula C13H14BrNO2S and a molecular weight of 328.23 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(2,4-dimethoxyphenyl)methanamine.
| Compound Name | (3-bromothiophen-2-yl)-(2,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 55240103 |
| Molecular Formula | C13H14BrNO2S |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | (3-bromothiophen-2-yl)-(2,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(C(N)c2sccc2Br)c(OC)c1 |
| InChI | InChI=1S/C13H14BrNO2S/c1-16-8-3-4-9(11(7-8)17-2)12(15)13-10(14)5-6-18-13/h3-7,12H,15H2,1-2H3 |
| InChIKey | KHFJRCMSFRNWHZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |