C17H17NO2S — CID 105021986
1-benzothiophen-7-yl-(2,4-dimethoxyphenyl)methanamine (PubChem CID 105021986) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-benzothiophen-7-yl-(2,4-dimethoxyphenyl)methanamine.
| Compound Name | 1-benzothiophen-7-yl-(2,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 105021986 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-benzothiophen-7-yl-(2,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(C(N)c2cccc3ccsc23)c(OC)c1 |
| InChI | InChI=1S/C17H17NO2S/c1-19-12-6-7-13(15(10-12)20-2)16(18)14-5-3-4-11-8-9-21-17(11)14/h3-10,16H,18H2,1-2H3 |
| InChIKey | USPFTVDBKMYMEM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |