C15H15BrFNO2 — CID 43197258
(2-bromo-5-fluorophenyl)-(2,4-dimethoxyphenyl)methanamine (PubChem CID 43197258) has the molecular formula C15H15BrFNO2 and a molecular weight of 340.19 g/mol. Its IUPAC name is (2-bromo-5-fluorophenyl)-(2,4-dimethoxyphenyl)methanamine.
| Compound Name | (2-bromo-5-fluorophenyl)-(2,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 43197258 |
| Molecular Formula | C15H15BrFNO2 |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (2-bromo-5-fluorophenyl)-(2,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(C(N)c2cc(F)ccc2Br)c(OC)c1 |
| InChI | InChI=1S/C15H15BrFNO2/c1-19-10-4-5-11(14(8-10)20-2)15(18)12-7-9(17)3-6-13(12)16/h3-8,15H,18H2,1-2H3 |
| InChIKey | SSYDKLLSDFJRDO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |