C12H15N3O2S — CID 105145174
(2,4-dimethoxyphenyl)-(4-methylthiadiazol-5-yl)methanamine (PubChem CID 105145174) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-(4-methylthiadiazol-5-yl)methanamine.
| Compound Name | (2,4-dimethoxyphenyl)-(4-methylthiadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105145174 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (2,4-dimethoxyphenyl)-(4-methylthiadiazol-5-yl)methanamine |
| SMILES | COc1ccc(C(N)c2snnc2C)c(OC)c1 |
| InChI | InChI=1S/C12H15N3O2S/c1-7-12(18-15-14-7)11(13)9-5-4-8(16-2)6-10(9)17-3/h4-6,11H,13H2,1-3H3 |
| InChIKey | IMHGFWSUDKTSGI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |