C13H11BrCl2S — CID 55200123
3-[bromo-(3,4-dimethylphenyl)methyl]-2,5-dichlorothiophene (PubChem CID 55200123) has the molecular formula C13H11BrCl2S and a molecular weight of 350.11 g/mol. Its IUPAC name is 3-[bromo-(3,4-dimethylphenyl)methyl]-2,5-dichlorothiophene.
| Compound Name | 3-[bromo-(3,4-dimethylphenyl)methyl]-2,5-dichlorothiophene |
|---|---|
| PubChem CID | 55200123 |
| Molecular Formula | C13H11BrCl2S |
| Molecular Weight | 350.11 g/mol |
| Exact Mass | 347.91 |
| IUPAC Name | 3-[bromo-(3,4-dimethylphenyl)methyl]-2,5-dichlorothiophene |
| SMILES | Cc1ccc(C(Br)c2cc(Cl)sc2Cl)cc1C |
| InChI | InChI=1S/C13H11BrCl2S/c1-7-3-4-9(5-8(7)2)12(14)10-6-11(15)17-13(10)16/h3-6,12H,1-2H3 |
| InChIKey | CTRKIBXLSNONPC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.11 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|