C15H13BrCl2O2S — CID 107964828
7-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 107964828) has the molecular formula C15H13BrCl2O2S and a molecular weight of 408.14 g/mol. Its IUPAC name is 7-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 107964828 |
| Molecular Formula | C15H13BrCl2O2S |
| Molecular Weight | 408.14 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | 7-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-3-methyl-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CC1COc2ccc(C(Br)c3cc(Cl)sc3Cl)cc2OC1 |
| InChI | InChI=1S/C15H13BrCl2O2S/c1-8-6-19-11-3-2-9(4-12(11)20-7-8)14(16)10-5-13(17)21-15(10)18/h2-5,8,14H,6-7H2,1H3 |
| InChIKey | CIRQHXLZOQHJFC-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.14 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|