C12H6BrCl2F3S — CID 63445127
3-[bromo-[4-(trifluoromethyl)phenyl]methyl]-2,5-dichlorothiophene (PubChem CID 63445127) has the molecular formula C12H6BrCl2F3S and a molecular weight of 390.05 g/mol. Its IUPAC name is 3-[bromo-[4-(trifluoromethyl)phenyl]methyl]-2,5-dichlorothiophene.
| Compound Name | 3-[bromo-[4-(trifluoromethyl)phenyl]methyl]-2,5-dichlorothiophene |
|---|---|
| PubChem CID | 63445127 |
| Molecular Formula | C12H6BrCl2F3S |
| Molecular Weight | 390.05 g/mol |
| Exact Mass | 387.87 |
| IUPAC Name | 3-[bromo-[4-(trifluoromethyl)phenyl]methyl]-2,5-dichlorothiophene |
| SMILES | FC(F)(F)c1ccc(C(Br)c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C12H6BrCl2F3S/c13-10(8-5-9(14)19-11(8)15)6-1-3-7(4-2-6)12(16,17)18/h1-5,10H |
| InChIKey | KNQQONIPWQMSHX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.05 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|