C12H5Br2Cl2F3S — CID 107333376
3-[bromo-[4-bromo-2-(trifluoromethyl)phenyl]methyl]-2,5-dichlorothiophene (PubChem CID 107333376) has the molecular formula C12H5Br2Cl2F3S and a molecular weight of 468.95 g/mol. Its IUPAC name is 3-[bromo-[4-bromo-2-(trifluoromethyl)phenyl]methyl]-2,5-dichlorothiophene.
| Compound Name | 3-[bromo-[4-bromo-2-(trifluoromethyl)phenyl]methyl]-2,5-dichlorothiophene |
|---|---|
| PubChem CID | 107333376 |
| Molecular Formula | C12H5Br2Cl2F3S |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 465.78 |
| IUPAC Name | 3-[bromo-[4-bromo-2-(trifluoromethyl)phenyl]methyl]-2,5-dichlorothiophene |
| SMILES | FC(F)(F)c1cc(Br)ccc1C(Br)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H5Br2Cl2F3S/c13-5-1-2-6(8(3-5)12(17,18)19)10(14)7-4-9(15)20-11(7)16/h1-4,10H |
| InChIKey | WILFLUGHXJOUNK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|