C14H7Br2F5 — CID 107333370
1-[bromo-[4-bromo-2-(trifluoromethyl)phenyl]methyl]-2,4-difluorobenzene (PubChem CID 107333370) has the molecular formula C14H7Br2F5 and a molecular weight of 430.01 g/mol. Its IUPAC name is 1-[bromo-[4-bromo-2-(trifluoromethyl)phenyl]methyl]-2,4-difluorobenzene.
| Compound Name | 1-[bromo-[4-bromo-2-(trifluoromethyl)phenyl]methyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 107333370 |
| Molecular Formula | C14H7Br2F5 |
| Molecular Weight | 430.01 g/mol |
| Exact Mass | 427.88 |
| IUPAC Name | 1-[bromo-[4-bromo-2-(trifluoromethyl)phenyl]methyl]-2,4-difluorobenzene |
| SMILES | Fc1ccc(C(Br)c2ccc(Br)cc2C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C14H7Br2F5/c15-7-1-3-9(11(5-7)14(19,20)21)13(16)10-4-2-8(17)6-12(10)18/h1-6,13H |
| InChIKey | NCUMUSYUOMBEMC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.01 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|