C15H11BrF4O — CID 62789466
[4-bromo-2-(trifluoromethyl)phenyl]-(5-fluoro-2-methylphenyl)methanol (PubChem CID 62789466) has the molecular formula C15H11BrF4O and a molecular weight of 363.15 g/mol. Its IUPAC name is [4-bromo-2-(trifluoromethyl)phenyl]-(5-fluoro-2-methylphenyl)methanol.
| Compound Name | [4-bromo-2-(trifluoromethyl)phenyl]-(5-fluoro-2-methylphenyl)methanol |
|---|---|
| PubChem CID | 62789466 |
| Molecular Formula | C15H11BrF4O |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | [4-bromo-2-(trifluoromethyl)phenyl]-(5-fluoro-2-methylphenyl)methanol |
| SMILES | Cc1ccc(F)cc1C(O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C15H11BrF4O/c1-8-2-4-10(17)7-12(8)14(21)11-5-3-9(16)6-13(11)15(18,19)20/h2-7,14,21H,1H3 |
| InChIKey | FJCQORROUGAPEO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |