C14H10ClF4NO — CID 106972147
[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(5-fluoro-2-methylphenyl)methanol (PubChem CID 106972147) has the molecular formula C14H10ClF4NO and a molecular weight of 319.69 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(5-fluoro-2-methylphenyl)methanol.
| Compound Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(5-fluoro-2-methylphenyl)methanol |
|---|---|
| PubChem CID | 106972147 |
| Molecular Formula | C14H10ClF4NO |
| Molecular Weight | 319.69 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(5-fluoro-2-methylphenyl)methanol |
| SMILES | Cc1ccc(F)cc1C(O)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C14H10ClF4NO/c1-7-2-3-8(16)6-10(7)12(21)9-4-5-11(14(17,18)19)20-13(9)15/h2-6,12,21H,1H3 |
| InChIKey | PTPGNHYEIXETKD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|