C11H6Cl2F3NOS — CID 106971530
(5-chlorothiophen-2-yl)-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol (PubChem CID 106971530) has the molecular formula C11H6Cl2F3NOS and a molecular weight of 328.14 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol.
| Compound Name | (5-chlorothiophen-2-yl)-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 106971530 |
| Molecular Formula | C11H6Cl2F3NOS |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | (5-chlorothiophen-2-yl)-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol |
| SMILES | OC(c1ccc(Cl)s1)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C11H6Cl2F3NOS/c12-8-4-2-6(19-8)9(18)5-1-3-7(11(14,15)16)17-10(5)13/h1-4,9,18H |
| InChIKey | VSIWZXLLWNJECT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|