C13H11ClF3NOS — CID 106971544
[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(2,5-dimethylthiophen-3-yl)methanol (PubChem CID 106971544) has the molecular formula C13H11ClF3NOS and a molecular weight of 321.75 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(2,5-dimethylthiophen-3-yl)methanol.
| Compound Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(2,5-dimethylthiophen-3-yl)methanol |
|---|---|
| PubChem CID | 106971544 |
| Molecular Formula | C13H11ClF3NOS |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(2,5-dimethylthiophen-3-yl)methanol |
| SMILES | Cc1cc(C(O)c2ccc(C(F)(F)F)nc2Cl)c(C)s1 |
| InChI | InChI=1S/C13H11ClF3NOS/c1-6-5-9(7(2)20-6)11(19)8-3-4-10(13(15,16)17)18-12(8)14/h3-5,11,19H,1-2H3 |
| InChIKey | HILXIBUGHFWEKU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|