C14H19ClF3NO — CID 106972121
1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-3,4,4-trimethylpentan-1-ol (PubChem CID 106972121) has the molecular formula C14H19ClF3NO and a molecular weight of 309.76 g/mol. Its IUPAC name is 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-3,4,4-trimethylpentan-1-ol.
| Compound Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-3,4,4-trimethylpentan-1-ol |
|---|---|
| PubChem CID | 106972121 |
| Molecular Formula | C14H19ClF3NO |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-3,4,4-trimethylpentan-1-ol |
| SMILES | CC(CC(O)c1ccc(C(F)(F)F)nc1Cl)C(C)(C)C |
| InChI | InChI=1S/C14H19ClF3NO/c1-8(13(2,3)4)7-10(20)9-5-6-11(14(16,17)18)19-12(9)15/h5-6,8,10,20H,7H2,1-4H3 |
| InChIKey | YXPBOFSEMXBUDW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|