C14H11ClF3NOS — CID 106972112
1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-2-phenylsulfanylethanol (PubChem CID 106972112) has the molecular formula C14H11ClF3NOS and a molecular weight of 333.76 g/mol. Its IUPAC name is 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-2-phenylsulfanylethanol.
| Compound Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-2-phenylsulfanylethanol |
|---|---|
| PubChem CID | 106972112 |
| Molecular Formula | C14H11ClF3NOS |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-2-phenylsulfanylethanol |
| SMILES | OC(CSc1ccccc1)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C14H11ClF3NOS/c15-13-10(6-7-12(19-13)14(16,17)18)11(20)8-21-9-4-2-1-3-5-9/h1-7,11,20H,8H2 |
| InChIKey | WZBZHPYSIUQPKD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|