C15H11ClF3NO — CID 106972145
7-bicyclo[4.2.0]octa-1,3,5-trienyl-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol (PubChem CID 106972145) has the molecular formula C15H11ClF3NO and a molecular weight of 313.71 g/mol. Its IUPAC name is 7-bicyclo[4.2.0]octa-1,3,5-trienyl-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol.
| Compound Name | 7-bicyclo[4.2.0]octa-1,3,5-trienyl-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 106972145 |
| Molecular Formula | C15H11ClF3NO |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 7-bicyclo[4.2.0]octa-1,3,5-trienyl-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol |
| SMILES | OC(c1ccc(C(F)(F)F)nc1Cl)C1Cc2ccccc21 |
| InChI | InChI=1S/C15H11ClF3NO/c16-14-10(5-6-12(20-14)15(17,18)19)13(21)11-7-8-3-1-2-4-9(8)11/h1-6,11,13,21H,7H2 |
| InChIKey | GZOQODPNEAMRMW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|