C13H8BrClF3NO — CID 106971491
(4-bromophenyl)-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol (PubChem CID 106971491) has the molecular formula C13H8BrClF3NO and a molecular weight of 366.56 g/mol. Its IUPAC name is (4-bromophenyl)-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol.
| Compound Name | (4-bromophenyl)-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 106971491 |
| Molecular Formula | C13H8BrClF3NO |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | (4-bromophenyl)-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol |
| SMILES | OC(c1ccc(Br)cc1)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C13H8BrClF3NO/c14-8-3-1-7(2-4-8)11(20)9-5-6-10(13(16,17)18)19-12(9)15/h1-6,11,20H |
| InChIKey | NMEODCGFUMYECK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|