C13H13ClF3N3O — CID 106971722
[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(1-propylpyrazol-4-yl)methanol (PubChem CID 106971722) has the molecular formula C13H13ClF3N3O and a molecular weight of 319.71 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(1-propylpyrazol-4-yl)methanol.
| Compound Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(1-propylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 106971722 |
| Molecular Formula | C13H13ClF3N3O |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(1-propylpyrazol-4-yl)methanol |
| SMILES | CCCn1cc(C(O)c2ccc(C(F)(F)F)nc2Cl)cn1 |
| InChI | InChI=1S/C13H13ClF3N3O/c1-2-5-20-7-8(6-18-20)11(21)9-3-4-10(13(15,16)17)19-12(9)14/h3-4,6-7,11,21H,2,5H2,1H3 |
| InChIKey | YDEAAZTYTWKJCC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|