C12H22N2O — CID 114981636
2,2-dimethyl-1-(1-propylpyrazol-4-yl)butan-1-ol (PubChem CID 114981636) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 2,2-dimethyl-1-(1-propylpyrazol-4-yl)butan-1-ol.
| Compound Name | 2,2-dimethyl-1-(1-propylpyrazol-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 114981636 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2,2-dimethyl-1-(1-propylpyrazol-4-yl)butan-1-ol |
| SMILES | CCCn1cc(C(O)C(C)(C)CC)cn1 |
| InChI | InChI=1S/C12H22N2O/c1-5-7-14-9-10(8-13-14)11(15)12(3,4)6-2/h8-9,11,15H,5-7H2,1-4H3 |
| InChIKey | GMIPUBWTNRHAPD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |