C14H26N2O — CID 114981667
3,4,4-trimethyl-1-(1-propylpyrazol-4-yl)pentan-1-ol (PubChem CID 114981667) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 3,4,4-trimethyl-1-(1-propylpyrazol-4-yl)pentan-1-ol.
| Compound Name | 3,4,4-trimethyl-1-(1-propylpyrazol-4-yl)pentan-1-ol |
|---|---|
| PubChem CID | 114981667 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 3,4,4-trimethyl-1-(1-propylpyrazol-4-yl)pentan-1-ol |
| SMILES | CCCn1cc(C(O)CC(C)C(C)(C)C)cn1 |
| InChI | InChI=1S/C14H26N2O/c1-6-7-16-10-12(9-15-16)13(17)8-11(2)14(3,4)5/h9-11,13,17H,6-8H2,1-5H3 |
| InChIKey | JXIXNJOWXQOMNI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |