C11H20N2O2 — CID 103449416
2-ethyl-1-(1-ethylpyrazol-4-yl)butane-1,2-diol (PubChem CID 103449416) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-ethyl-1-(1-ethylpyrazol-4-yl)butane-1,2-diol.
| Compound Name | 2-ethyl-1-(1-ethylpyrazol-4-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 103449416 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-ethyl-1-(1-ethylpyrazol-4-yl)butane-1,2-diol |
| SMILES | CCn1cc(C(O)C(O)(CC)CC)cn1 |
| InChI | InChI=1S/C11H20N2O2/c1-4-11(15,5-2)10(14)9-7-12-13(6-3)8-9/h7-8,10,14-15H,4-6H2,1-3H3 |
| InChIKey | ZDHLMESWYMMFAE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |