C13H7ClF5NO — CID 106971514
[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(3,4-difluorophenyl)methanol (PubChem CID 106971514) has the molecular formula C13H7ClF5NO and a molecular weight of 323.65 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(3,4-difluorophenyl)methanol.
| Compound Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(3,4-difluorophenyl)methanol |
|---|---|
| PubChem CID | 106971514 |
| Molecular Formula | C13H7ClF5NO |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(3,4-difluorophenyl)methanol |
| SMILES | OC(c1ccc(F)c(F)c1)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C13H7ClF5NO/c14-12-7(2-4-10(20-12)13(17,18)19)11(21)6-1-3-8(15)9(16)5-6/h1-5,11,21H |
| InChIKey | JIBXZXAZDKHYAN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|