C8H5ClF4O — CID 112575331
2-chloro-1-(3,4-difluorophenyl)-2,2-difluoroethanol (PubChem CID 112575331) has the molecular formula C8H5ClF4O and a molecular weight of 228.57 g/mol. Its IUPAC name is 2-chloro-1-(3,4-difluorophenyl)-2,2-difluoroethanol.
| Compound Name | 2-chloro-1-(3,4-difluorophenyl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 112575331 |
| Molecular Formula | C8H5ClF4O |
| Molecular Weight | 228.57 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 2-chloro-1-(3,4-difluorophenyl)-2,2-difluoroethanol |
| SMILES | OC(c1ccc(F)c(F)c1)C(F)(F)Cl |
| InChI | InChI=1S/C8H5ClF4O/c9-8(12,13)7(14)4-1-2-5(10)6(11)3-4/h1-3,7,14H |
| InChIKey | VGSWTMLYWJMFLV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|